
| Compound-ID | 14414 |
| Common Name | 4-Demethylpremithramycinone |
| InChI |
InChI=1/C20H16O9/c1-6(21)12-17(26)15(24)10-4-8-2-7-3-9(22)5-11(23)13(7)16(25)14(8)19(28)20(10,29)18(12)27/h2-3,5,10,15,22-26,29H,4H2,1H3/t10-,15-,20+/m0/s1
|
| SMILES |
[H]C34(Cc2cc1cc(O)cc(O)c1c(O)c2C(=O)C4(O)(C(=O)C(C(C)=O)=C(O)C3(O)))
|
| External Links | |
| KEGG-COMPOUND-ID |
C12382
|
| PUBCHEM-ID | 582772 |
|
View all entries for compound: 4-Demethylpremithramycinone |