
| Compound-ID | 1871 |
| Common Name | Xanthine |
| InChI |
InChI=1S/C5H4N4O2/c10-4-2-3(7-1-6-2)8-5(11)9-4/h1H,(H3,6,7,8,9,10,11)
|
| SMILES |
O=C1NC(=O)c2ncnc2(N1)
|
| External Links | |
| KEGG-COMPOUND-ID |
C00385
|
| PUBCHEM-ID | 3675 |
| ChEBI-ID |
17712
15318 48517 46377 27317 10059 |
| REACTOME-ID | 30064 |
| METACYC-ID | XANTHINE |
| METANETX-ID | MNXM174 |
| BioModels |
17712 15318 |
|
View all entries for compound: Xanthine |