
| Compound-ID | 20662 |
| Common Name | 3-Methylsalicylate |
| InChI |
InChI=1S/C8H8O3/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4,9H,1H3,(H,10,11)
|
| SMILES |
Cc1cccc(C(=O)O)c1(O)
|
| External Links | |
| KEGG-COMPOUND-ID |
C14088
|
| PUBCHEM-ID | 854324 |
| ChEBI-ID |
20141
|
|
View all entries for compound: 3-Methylsalicylate |