
| Compound-ID | 21167 |
| Common Name | Monomyristin |
| InChI |
InChI=1S/C17H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(20)21-15-16(19)14-18/h16,18-19H,2-15H2,1H3
|
| External Links | |
| ChEBI-ID |
75562
75567 75538 75536 |
| REACTOME-ID | 8934414 |
| METACYC-ID | CPD-20406 |
| METANETX-ID | MNXM62035 |
|
View all entries for compound: Monomyristin |