
| Compound-ID | 21471 |
| Common Name | 4-Androstenediol |
| Synonyms |
Androst-4-ene-3beta,17beta-diol
|
| InChI |
InChI=1/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,13-17,20-21H,3-10H2,1-2H3/t13-,14-,15-,16-,17-,18-,19-/m0/s1
|
| SMILES |
[H]C24(CCC1=CC(O)CCC1(C)C4([H])(CCC3(C)(C(O)CCC23([H]))))
|
| External Links | |
| KEGG-COMPOUND-ID |
C14210
|
| PUBCHEM-ID | 7847020 |
| METANETX-ID | MNXM728998 |
|
View all entries for compound: 4-Androstenediol |