
| Compound-ID | 25845 |
| Common Name | 4-Methoxyphenylglyoxal |
| InChI |
InChI=1S/C9H8O3/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-6H,1H3
|
| SMILES |
COc1ccc(cc1)C(=O)C=O
|
| External Links | |
| CHEMSPIDER-ID | 63809 |
| METANETX-ID | MNXM164308 |
|
View all entries for compound: 4-Methoxyphenylglyoxal |