
| Compound-ID | 25851 |
| Common Name | 4-Bromophenylglyoxal |
| InChI |
InChI=1S/C8H5BrO2/c9-7-3-1-6(2-4-7)8(11)5-10/h1-5H
|
| SMILES |
c1cc(ccc1C(=O)C=O)Br
|
| External Links | |
| CHEMSPIDER-ID | 203669 |
| METANETX-ID | MNXM164290 |
|
View all entries for compound: 4-Bromophenylglyoxal |