
| Compound-ID | 25852 |
| Common Name | 3-Methoxyphenylglyoxal |
| InChI |
InChI=1S/C9H8O3/c1-12-8-4-2-3-7(5-8)9(11)6-10/h2-6H,1H3
|
| SMILES |
COc1cccc(c1)C(=O)C=O
|
| External Links | |
| PUBCHEM-CID | 3080767 |
| CHEMSPIDER-ID | 2338501 |
| METANETX-ID | MNXM164251 |
|
View all entries for compound: 3-Methoxyphenylglyoxal |