
| Compound-ID | 27121 |
| Common Name | p-Hydroxyphenylglyoxal |
| InChI |
InChI=1S/C8H6O3/c9-5-8(11)6-1-3-7(10)4-2-6/h1-5,10H
|
| SMILES |
c1cc(ccc1C(=O)C=O)O
|
| External Links | |
| PUBCHEM-CID | 90568 |
| CHEMSPIDER-ID | 81774 |
| METANETX-ID | MNXM168769 |
|
View all entries for compound: p-Hydroxyphenylglyoxal |