
| Compound-ID | 27986 |
| Common Name | 4-Nitro-3-trifluoromethyl-phenylamine |
| InChI |
InChI=1S/C7H5F3N2O2/c8-7(9,10)5-3-4(11)1-2-6(5)12(13)14/h1-3H,11H2
|
| SMILES |
c1cc(c(cc1N)C(F)(F)F)[N+](=O)[O-]
|
| External Links | |
| PUBCHEM-CID | 94955 |
| CHEMSPIDER-ID | 85677 |
|
View all entries for compound: 4-Nitro-3-trifluoromethyl-phenylamine |