
| Compound-ID | 28941 |
| Common Name | N-Palmitoylsphingosine |
| Synonyms |
C16-Ceramide
|
| InChI |
InChI=1S/C34H67NO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-33(37)32(31-36)35-34(38)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h27,29,32-33,36-37H,3-26,28,30-31H2,1-2H3,(H,35,38)/b29-27+
|
|
View all entries for compound: N-Palmitoylsphingosine |