
| Compound-ID | 32307 |
| Common Name | 1-Hexadecanoyl-sn-glycerol |
| Synonyms |
1-Palmitoyl-sn-glycerol
|
| InChI |
InChI=1S/C19H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-17-18(21)16-20/h18,20-21H,2-17H2,1H3/t18-/m0/s1
|
| SMILES |
CCCCCCCCCCCCCCCC(=O)OC[C@H](CO)O
|
| External Links | |
| PUBCHEM-CID | 3084463 |
| ChEBI-ID |
75542
|
| CHEMSPIDER-ID | 2341519 |
|
View all entries for compound: 1-Hexadecanoyl-sn-glycerol |