
| Compound-ID | 33601 |
| Common Name | 4,4-Dimethyl-5alpha-cholesta-8,14-dien-3beta-ol |
| Synonyms |
4,4-Dimethylcholesta-8,14-dien-3-ol
|
| InChI |
InChI=1S/C29H48O/c1-19(2)9-8-10-20(3)22-12-13-23-21-11-14-25-27(4,5)26(30)16-18-29(25,7)24(21)15-17-28(22,23)6/h13,19-20,22,25-26,30H,8-12,14-18H2,1-7H3/t20-,22-,25+,26+,28-,29-/m1/s1
|
| SMILES |
C[C@H](CCCC(C)C)[C@H]1CC=C2[C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)C
|
| External Links | |
| PUBCHEM-CID | 167817 |
| ChEBI-ID |
78904
|
| CHEMSPIDER-ID | 146803 |
|
View all entries for compound: 4,4-Dimethyl-5alpha-cholesta-8,14-dien-3beta-ol |