
| Compound-ID | 6106 |
| Common Name | Dihydrocoumarin |
| Synonyms |
3,4-Dihydrocoumarin
|
| InChI |
InChI=1S/C9H8O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-4H,5-6H2
|
| SMILES |
O=C1CCc2ccccc2(O1)
|
| External Links | |
| KEGG-COMPOUND-ID |
C02274
|
| PUBCHEM-ID | 5334 |
| ChEBI-ID |
16151
|
|
View all entries for compound: Dihydrocoumarin |