
| Compound-ID | 6495 |
| Common Name | 4,5-Dihydroxyphthalate |
| InChI |
InChI=1S/C8H6O6/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2,9-10H,(H,11,12)(H,13,14)
|
| SMILES |
OC(=O)c1cc(O)c(O)cc1(C(O)=O)
|
| External Links | |
| KEGG-COMPOUND-ID |
C03233
|
| PUBCHEM-ID | 6104 |
| ChEBI-ID |
17199
|
|
View all entries for compound: 4,5-Dihydroxyphthalate |