
| Compound-ID | 7457 |
| Common Name | 2,3-Bis-O-(geranylgeranyl)glycerol 1-phosphate |
| InChI |
InChI=1S/C43H73O6P/c1-35(2)17-11-19-37(5)21-13-23-39(7)25-15-27-41(9)29-31-47-33-43(34-49-50(44,45)46)48-32-30-42(10)28-16-26-40(8)24-14-22-38(6)20-12-18-36(3)4/h17-18,21-22,25-26,29-30,43H,11-16,19-20,23-24,27-28,31-34H2,1-10H3,(H2,44,45,46)/b37-21+,38-22+,39-25+,40-26+,41-29+,42-30+
|
| SMILES |
CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOCC(COP(O)(O)=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C
|
| External Links | |
| KEGG-COMPOUND-ID |
C04638
|
| PUBCHEM-ID | 7227 |
| ChEBI-ID |
16266
|
|
View all entries for compound: 2,3-Bis-O-(geranylgeranyl)glycerol 1-phosphate |