
| Compound-ID | 7993 |
| Common Name | Gentisate aldehyde |
| InChI |
InChI=1S/C7H6O3/c8-4-5-3-6(9)1-2-7(5)10/h1-4,9-10H
|
| SMILES |
O=Cc1cc(O)ccc1(O)
|
| External Links | |
| KEGG-COMPOUND-ID |
C05585
|
| PUBCHEM-ID | 7911 |
| ChEBI-ID |
28508
|
| BioModels |
28508 |
|
View all entries for compound: Gentisate aldehyde |