
| Compound-ID | 9112 |
| Common Name | Famciclovir |
| InChI |
InChI=1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18)
|
| External Links | |
| KEGG-COMPOUND-ID |
D00317
|
| ChEBI-ID |
4974
174284 |
| METANETX-ID | MNXM53088 |
|
View all entries for compound: Famciclovir |