
| Compound-ID | 9821 |
| Common Name | 3,4-Dihydroxyfluorene |
| InChI |
InChI=1/C13H10O2/c14-11-6-5-9-7-8-3-1-2-4-10(8)12(9)13(11)15/h1-6,14-15H,7H2
|
| SMILES |
Oc3ccc2Cc1ccccc1c2c3(O)
|
| External Links | |
| KEGG-COMPOUND-ID |
C07717
|
| PUBCHEM-ID | 9919 |
|
View all entries for compound: 3,4-Dihydroxyfluorene |