
| Compound-ID | 9828 |
| Common Name | 1,2-Dihydroxyfluorene |
| InChI |
InChI=1S/C13H10O2/c14-12-6-5-10-9-4-2-1-3-8(9)7-11(10)13(12)15/h1-6,14-15H,7H2
|
| SMILES |
Oc1ccc2c3ccccc3(Cc2(c1(O)))
|
| External Links | |
| KEGG-COMPOUND-ID |
C07724
|
| PUBCHEM-ID | 9926 |
| ChEBI-ID |
28565
|
|
View all entries for compound: 1,2-Dihydroxyfluorene |